CymitQuimica logo

CAS 902837-46-1

:

2-(Cyclohexyloxy)-3-iodopyridine

Description:
2-(Cyclohexyloxy)-3-iodopyridine is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a cyclohexyloxy group and an iodine atom. The presence of the iodine atom introduces notable reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The cyclohexyloxy group contributes to the compound's hydrophobic characteristics, influencing its solubility and interaction with biological systems. This compound may exhibit interesting pharmacological properties, as many pyridine derivatives are known for their biological activity. Additionally, the molecular structure suggests potential applications in organic synthesis and medicinal chemistry, particularly in the development of new therapeutic agents. Its specific properties, such as melting point, boiling point, and spectral data, would typically be determined through experimental methods. As with many halogenated compounds, safety precautions should be taken when handling this substance due to the potential for toxicity and environmental impact.
Formula:C11H14INO
InChI:InChI=1S/C11H14INO/c12-10-7-4-8-13-11(10)14-9-5-2-1-3-6-9/h4,7-9H,1-3,5-6H2
InChI key:InChIKey=VHOAFUFCTVSRBC-UHFFFAOYSA-N
SMILES:O(C1=C(I)C=CC=N1)C2CCCCC2
Synonyms:
  • Pyridine, 2-(cyclohexyloxy)-3-iodo-
  • 2-(Cyclohexyloxy)-3-iodopyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.