CAS 902837-49-4

2-(Cyclopentyloxy)-3-pyridinecarboxaldehyde

Description:

2-(Cyclopentyloxy)-3-pyridinecarboxaldehyde is an organic compound characterized by its unique structure, which includes a pyridine ring and an aldehyde functional group. The presence of the cyclopentyloxy group contributes to its distinctive chemical properties, influencing its reactivity and solubility. This compound typically exhibits moderate polarity due to the combination of the aromatic pyridine and the aliphatic cyclopentyl moiety. It may participate in various chemical reactions, such as nucleophilic additions and condensation reactions, owing to the aldehyde functionality. Additionally, the compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as derivatives of pyridine are often associated with biological activity. Its synthesis and characterization would involve standard organic chemistry techniques, including spectroscopy methods like NMR and IR for structural confirmation. Overall, 2-(Cyclopentyloxy)-3-pyridinecarboxaldehyde represents a versatile building block in organic synthesis and may hold significance in various chemical research fields.

Formula: C₁₁H₁₃NO₂

InChI: InChI=1S/C11H13NO2/c13-8-9-4-3-7-12-11(9)14-10-5-1-2-6-10/h3-4,7-8,10H,1-2,5-6H2

InChI key: InChIKey=QFHKBAVBMVWDEF-UHFFFAOYSA-N

SMILES: O(C1=C(C=O)C=CC=N1)C2CCCC2

Synonyms:

• 2-Cyclopentyloxypyridine-3-carbaldehyde
• 2-Cyclopentyloxypyridine-3-carboxaldehyde
• 2-(Cyclopentyloxy)-3-pyridinecarboxaldehyde
• 3-Pyridinecarboxaldehyde, 2-(cyclopentyloxy)-
• 2-(Cyclopentyloxy)pyridine-3-carbaldehyde