CAS 902837-59-6

2-(Cyclohexyloxy)-5-iodopyridine

Description:

2-(Cyclohexyloxy)-5-iodopyridine is an organic compound characterized by its pyridine ring, which is substituted at the 2-position with a cyclohexyloxy group and at the 5-position with an iodine atom. This compound typically exhibits properties associated with both aromatic and aliphatic systems due to the presence of the pyridine and cyclohexyl moieties. It is likely to be a solid at room temperature, with moderate solubility in organic solvents such as ethanol and dichloromethane, while being less soluble in water due to its hydrophobic cyclohexyl group. The iodine substituent can impart unique reactivity, making it a potential candidate for various chemical transformations, including nucleophilic substitutions. Additionally, the presence of the cyclohexyloxy group may influence the compound's electronic properties and steric hindrance, affecting its reactivity and interactions in biological systems. Overall, 2-(Cyclohexyloxy)-5-iodopyridine is of interest in medicinal chemistry and materials science for its potential applications in drug development and as a building block in organic synthesis.

Formula: C₁₁H₁₄INO

InChI: InChI=1S/C11H14INO/c12-9-6-7-11(13-8-9)14-10-4-2-1-3-5-10/h6-8,10H,1-5H2

InChI key: InChIKey=WPSQDKMWLFYZTL-UHFFFAOYSA-N

SMILES: O(C1=CC=C(I)C=N1)C2CCCCC2

Synonyms:

• Pyridine, 2-(cyclohexyloxy)-5-iodo-
• 2-(Cyclohexyloxy)-5-iodopyridine
• 2-Cyclohexyloxy-5-iodopyridine