CAS 90287-80-2

(2-chloropyridin-4-yl)(piperidin-1-yl)methanone

Description:

(2-chloropyridin-4-yl)(piperidin-1-yl)methanone, with the CAS number 90287-80-2, is a chemical compound characterized by its unique structural features. It consists of a pyridine ring substituted with a chlorine atom at the 2-position and a carbonyl group attached to a piperidine moiety. This compound exhibits properties typical of both heterocyclic and aliphatic compounds, contributing to its potential biological activity. The presence of the chloropyridine group may enhance lipophilicity and influence its interaction with biological targets, while the piperidine ring can provide basicity and steric effects. Such structural characteristics suggest that this compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its reactivity can be influenced by the functional groups present, making it a candidate for various synthetic applications. Additionally, the compound's solubility, stability, and potential toxicity would need to be evaluated in the context of its intended use. Overall, (2-chloropyridin-4-yl)(piperidin-1-yl)methanone represents a versatile scaffold for further chemical exploration.

Formula: C₁₁H₁₃ClN₂O

InChI: InChI=1/C11H13ClN2O/c12-10-8-9(4-5-13-10)11(15)14-6-2-1-3-7-14/h4-5,8H,1-3,6-7H2

SMILES: C1CCN(CC1)C(=O)c1ccnc(c1)Cl

Synonyms:

• Methanone, (2-Chloro-4-Pyridinyl)-1-Piperidinyl-

2-chloro-4-(1-piperidinylcarbonyl)pyridine

CAS: 90287-80-2

Formula: C₁₁H₁₃ClN₂O

Purity: 95.0%

Molecular weight: 224.69

Ref: 10-F310514