CAS 90288-29-2
:(2Z,4R)-4-amino-3-chloropent-2-enedioic acid
Description:
(2Z,4R)-4-amino-3-chloropent-2-enedioic acid, also known as a derivative of aspartic acid, is an amino acid characterized by its unique structural features. It contains a double bond between the second and third carbon atoms, which contributes to its reactivity and potential biological activity. The presence of an amino group (-NH2) and a chlorinated carbon atom enhances its chemical properties, making it a polar compound that can participate in various biochemical reactions. This compound is typically soluble in water due to its polar functional groups, which allows it to interact with biological systems effectively. Its stereochemistry, indicated by the (2Z,4R) configuration, suggests specific spatial arrangements that can influence its interaction with enzymes and receptors. As a chlorinated amino acid, it may exhibit unique pharmacological properties, making it of interest in medicinal chemistry and biochemistry. Overall, this compound's characteristics make it a valuable subject for research in various fields, including drug development and metabolic studies.
Formula:C5H6ClNO4
InChI:InChI=1/C5H6ClNO4/c6-2(1-3(8)9)4(7)5(10)11/h1,4H,7H2,(H,8,9)(H,10,11)/b2-1-/t4-/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
[R-(Z)]-4-Amino-3-chloro-2-pen-tenedioicacid
CAS:<p>[R-(Z)]-4-Amino-3-chloro-2-pentenedioic acid inhibits Micrococcus luteus.</p>Formula:C5H6ClNO4Color and Shape:SolidMolecular weight:179.56
