CAS 90301-67-0
:2'-deoxy-5-(2-iodoethyl)uridine
Description:
2'-Deoxy-5-(2-iodoethyl)uridine is a modified nucleoside that features a uridine base with a 2-iodoethyl group attached at the 5-position of the pyrimidine ring. This compound is characterized by its structural components, which include a deoxyribose sugar moiety, making it a derivative of deoxyuridine. The presence of the iodine atom introduces unique properties, such as increased lipophilicity and potential for biological activity, particularly in the context of antiviral or anticancer research. The iodine substituent can also facilitate radiolabeling for imaging studies. In terms of solubility, it is typically soluble in polar organic solvents, which is common for nucleoside derivatives. The compound's reactivity may be influenced by the presence of the iodine atom, allowing for further chemical modifications or interactions with biological targets. Overall, 2'-deoxy-5-(2-iodoethyl)uridine serves as a valuable tool in medicinal chemistry and molecular biology, particularly in the development of therapeutic agents.
Formula:C11H15IN2O5
InChI:InChI=1/C11H15IN2O5/c12-2-1-6-4-14(11(18)13-10(6)17)9-3-7(16)8(5-15)19-9/h4,7-9,15-16H,1-3,5H2,(H,13,17,18)/t7-,8+,9+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2'-Deoxy-5-(2-iodoethyl)uridine
CAS:<p>2'-Deoxy-5-(2-iodoethyl)uridine is a nucleoside analog with antiviral and anticancer activity. It has been shown to be an activator of DNA replication, as well as inhibiting the synthesis of deoxyribonucleotides. This drug also has a novel structure that is modified from the natural nucleosides found in DNA and RNA. 2'-Deoxy-5-(2-iodoethyl)uridine can be synthesized using phosphoramidites, which are activated by iodine and sulfurizing agents. The purity of this compound is high and it is available at high quality.</p>Purity:Min. 95%
