CAS 90301-73-8

5-(2-chloroethyl)-1-(2-deoxy-2-fluoro-beta-D-arabinofuranosyl)pyrimidine-2,4(1H,3H)-dione

Description:

5-(2-Chloroethyl)-1-(2-deoxy-2-fluoro-beta-D-arabinofuranosyl)pyrimidine-2,4(1H,3H)-dione, with CAS number 90301-73-8, is a synthetic nucleoside analog that exhibits characteristics typical of pyrimidine derivatives. This compound features a pyrimidine ring substituted with a 2-chloroethyl group and a 2-deoxy-2-fluoro-beta-D-arabinofuranosyl moiety, which enhances its potential for biological activity. The presence of the chloroethyl group suggests that it may have alkylating properties, which can be relevant in the context of antitumor activity. The fluorine substitution on the sugar moiety can influence the compound's metabolic stability and interaction with nucleic acid targets. As a nucleoside analog, it may interfere with nucleic acid synthesis, making it of interest in antiviral and anticancer research. Its solubility, stability, and reactivity would depend on the specific conditions of use, including pH and solvent. Overall, this compound represents a class of molecules that are being explored for their therapeutic potential in various diseases, particularly in oncology.

Formula: C₁₁H₁₄ClFN₂O₅

InChI: InChI=1/C11H14ClFN2O5/c12-2-1-5-3-15(11(19)14-9(5)18)10-7(13)8(17)6(4-16)20-10/h3,6-8,10,16-17H,1-2,4H2,(H,14,18,19)/t6-,7+,8-,10-/m1/s1