CAS 903094-74-6
:2-(Trifluoromethyl)benzeneethanimidamide
Description:
2-(Trifluoromethyl)benzeneethanimidamide, identified by its CAS number 903094-74-6, is a chemical compound characterized by the presence of a trifluoromethyl group attached to a benzene ring, along with an ethanimidamide functional group. This compound typically exhibits properties associated with both aromatic and amide functionalities, which can influence its reactivity and solubility. The trifluoromethyl group is known for imparting unique electronic properties, often enhancing the compound's lipophilicity and stability. As an amide, it may participate in hydrogen bonding, affecting its interactions in various chemical environments. The presence of fluorine atoms can also enhance the compound's resistance to metabolic degradation, making it of interest in pharmaceutical applications. Overall, 2-(Trifluoromethyl)benzeneethanimidamide is a versatile compound with potential utility in organic synthesis and medicinal chemistry, though specific applications would depend on further research into its biological activity and reactivity.
Formula:C9H9F3N2
InChI:InChI=1S/C9H9F3N2/c10-9(11,12)7-4-2-1-3-6(7)5-8(13)14/h1-4H,5H2,(H3,13,14)
InChI key:InChIKey=HTNUTJNKQPSODI-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(CC(=N)N)C=CC=C1
Synonyms:- Benzeneethanimidamide, 2-(trifluoromethyl)-
- 2-[2-(Trifluoromethyl)phenyl]ethanimidamide
- 2-(Trifluoromethyl)benzeneethanimidamide
- 2-(2-Trifluoromethyl-phenyl)-acetamidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.