CymitQuimica logo

CAS 903129-86-2

:

9H-fluoren-9-ylmethyl 2,4-dichloro-5,7-dihydro-6H-pyrrolo[3,4-d]pyrimidine-6-carboxylate

Description:
9H-fluoren-9-ylmethyl 2,4-dichloro-5,7-dihydro-6H-pyrrolo[3,4-d]pyrimidine-6-carboxylate, with the CAS number 903129-86-2, is a synthetic organic compound characterized by its complex structure, which includes a fluorenylmethyl group and a pyrrolo[3,4-d]pyrimidine moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential stability under standard laboratory conditions. Its structure suggests it may possess biological activity, possibly as a pharmaceutical agent, due to the presence of the pyrimidine ring, which is often associated with various biological functions. The dichloro substituents may influence its reactivity and interaction with biological targets. Additionally, the carboxylate group can participate in hydrogen bonding and ionic interactions, which may enhance its solubility and bioavailability. Overall, this compound's unique structural features make it a subject of interest in medicinal chemistry and drug development, although specific biological activities and applications would require further investigation.
Formula:C21H15Cl2N3O2
InChI:InChI=1/C21H15Cl2N3O2/c22-19-16-9-26(10-18(16)24-20(23)25-19)21(27)28-11-17-14-7-3-1-5-12(14)13-6-2-4-8-15(13)17/h1-8,17H,9-11H2
SMILES:c1ccc2c(c1)c1ccccc1C2COC(=O)N1Cc2c(C1)nc(Cl)nc2Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.