CymitQuimica logo

CAS 903130-16-5

:

9H-Fluoren-9-ylmethyl 2,4-dichloro-7,8-dihydropyrido[4,3-d]pyrimidine-6(5H)-carboxylate

Description:
9H-Fluoren-9-ylmethyl 2,4-dichloro-7,8-dihydropyrido[4,3-d]pyrimidine-6(5H)-carboxylate is a chemical compound characterized by its complex structure, which includes a fluorenylmethyl group and a pyrido-pyrimidine moiety. This compound features multiple functional groups, including carboxylate and dichloro substituents, which contribute to its chemical reactivity and potential biological activity. The presence of the pyrido[4,3-d]pyrimidine framework suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural similarity to biologically active compounds. The compound is likely to exhibit moderate to high lipophilicity, influencing its solubility and permeability properties. Additionally, the dichloro substituents may enhance its reactivity in various chemical reactions. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact of this compound would need to be assessed through further studies. Overall, this compound represents a unique structure with potential applications in drug discovery and development.
Formula:C22H17Cl2N3O2
InChI:InChI=1S/C22H17Cl2N3O2/c23-20-17-11-27(10-9-19(17)25-21(24)26-20)22(28)29-12-18-15-7-3-1-5-13(15)14-6-2-4-8-16(14)18/h1-8,18H,9-12H2
InChI key:InChIKey=AYCKHGGFLCWKMC-UHFFFAOYSA-N
SMILES:C(OC(=O)N1CC=2C(CC1)=NC(Cl)=NC2Cl)C3C=4C(C=5C3=CC=CC5)=CC=CC4
Synonyms:
  • 9H-Fluoren-9-ylmethyl 2,4-dichloro-7,8-dihydropyrido[4,3-d]pyrimidine-6(5H)-carboxylate
  • Pyrido[4,3-d]pyrimidine-6(5H)-carboxylic acid, 2,4-dichloro-7,8-dihydro-, 9H-fluoren-9-ylmethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.