CymitQuimica logo

CAS 903130-23-4

:

Ethyl 3-chloro-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine-2-carboxylate

Description:
Ethyl 3-chloro-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine-2-carboxylate is a chemical compound characterized by its complex bicyclic structure, which includes an imidazo and pyrazine moiety. This compound features a chloro substituent and an ethyl ester functional group, contributing to its reactivity and potential applications in medicinal chemistry. The presence of the tetrahydro configuration indicates that the compound is saturated, which can influence its biological activity and solubility. Typically, compounds of this nature may exhibit interesting pharmacological properties, making them candidates for further research in drug development. Its molecular structure suggests potential interactions with biological targets, and the chloro group may enhance lipophilicity or alter metabolic pathways. As with many heterocyclic compounds, the synthesis and characterization of this substance would involve standard organic chemistry techniques, including NMR, mass spectrometry, and possibly X-ray crystallography for structural confirmation. Overall, ethyl 3-chloro-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine-2-carboxylate represents a unique scaffold for exploration in various chemical and pharmaceutical applications.
Formula:C9H12ClN3O2
InChI:InChI=1S/C9H12ClN3O2/c1-2-15-9(14)7-8(10)13-4-3-11-5-6(13)12-7/h11H,2-5H2,1H3
InChI key:InChIKey=FSPLEMJWDPSQPC-UHFFFAOYSA-N
SMILES:ClC=1N2C(=NC1C(OCC)=O)CNCC2
Synonyms:
  • Ethyl 3-Chloro-5,6,7,8-Tetrahydroimidazo[1,2-A]Pyrazine-2-Carboxylate Hydrochloride
  • Imidazo[1,2-a]pyrazine-2-carboxylic acid, 3-chloro-5,6,7,8-tetrahydro-, ethyl ester
  • Ethyl 3-chloro-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine-2-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.