CAS 903131-21-5
:3-bromo-7-methyl-1H-indole
Description:
3-Bromo-7-methyl-1H-indole is a chemical compound that belongs to the indole family, characterized by a bicyclic structure consisting of a benzene ring fused to a pyrrole ring. The presence of a bromine atom at the 3-position and a methyl group at the 7-position distinguishes this compound, influencing its reactivity and properties. Typically, indoles exhibit aromatic characteristics, contributing to their stability and unique electronic properties. This compound may be utilized in various applications, including organic synthesis and medicinal chemistry, due to its potential biological activity. Indoles are known for their presence in many natural products and pharmaceuticals, often exhibiting diverse pharmacological effects. The bromine substituent can enhance the compound's reactivity in electrophilic substitution reactions, while the methyl group may affect its solubility and interaction with biological targets. Overall, 3-bromo-7-methyl-1H-indole represents a valuable structure in the field of organic chemistry, with implications for further research and development in drug discovery and material science.
Formula:C9H8BrN
InChI:InChI=1/C9H8BrN/c1-6-3-2-4-7-8(10)5-11-9(6)7/h2-5,11H,1H3
Synonyms:- 3-Bromo-7-methyl-1H-indole
- 1H-Indole, 3-bromo-7-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.