CAS 90319-06-5

2-(Acetylamino)-2-deoxy-α-L-talopyranuronic acid

Description:

2-(Acetylamino)-2-deoxy-α-L-talopyranuronic acid, with the CAS number 90319-06-5, is a derivative of a sugar acid and belongs to the class of amino sugars. This compound features an acetylamino group, which contributes to its biological activity and solubility properties. Structurally, it contains a pyranose ring, which is characteristic of many carbohydrates, and the presence of a carboxylic acid group indicates its acidic nature. The specific stereochemistry of the α-L-talopyranuronic acid configuration suggests that it has distinct spatial arrangements that can influence its interactions with biological molecules, such as enzymes and receptors. This compound may exhibit various biological activities, including potential roles in cell signaling or as a component of glycoproteins. Its solubility in water and other solvents can vary based on the pH and the presence of other ions, making it relevant in biochemical applications. Overall, 2-(Acetylamino)-2-deoxy-α-L-talopyranuronic acid is significant in the study of carbohydrates and their derivatives in biological systems.

Formula: C₈H₁₃NO₇

InChI: InChI=1S/C8H13NO7/c1-2(10)9-3-4(11)5(12)6(7(13)14)16-8(3)15/h3-6,8,11-12,15H,1H3,(H,9,10)(H,13,14)/t3-,4+,5+,6-,8-/m1/s1

InChI key: InChIKey=KSOXQRPSZKLEOR-USOLSPIOSA-N

SMILES: N(C(C)=O)[C@@H]1[C@H](O)[C@H](O)[C@H](C(O)=O)O[C@H]1O

Synonyms:

• α-L-Talopyranuronic acid, 2-(acetylamino)-2-deoxy-
• 2-(Acetylamino)-2-deoxy-α-L-talopyranuronic acid

N-Acetyl-L-talosaminuronic acid

CAS: 90319-06-5

N-Acetyl-L-talosaminuronic acid is a natural product that has been shown to have anti-inflammatory activity in experimental models of inflammatory bowel disease. N-Acetyl-L-talosaminuronic acid inhibits the production of proinflammatory cytokines, such as tumor necrosis factor alpha (TNFα), by binding to TNFα receptors on the surface of cells. This can be attributed to its ability to inhibit ATP levels and reduce oxidative stress, which are both factors that contribute to inflammation. N-Acetyl-L-talosaminuronic acid also has been shown to inhibit inflammatory responses in human monocytes and neutrophils. It binds specifically to her2+ breast cancer cells and inhibits their growth in culture. Furthermore, it has been shown to have cytotoxic effects on bladder cancer cells and can be used for the treatment of bladder cancer.

Formula: C₈H₁₃NO₇

Purity: Min. 95 Area-%

Color and Shape: Powder

Molecular weight: 235.19 g/mol

Ref: 3D-MA63240