CymitQuimica logo

CAS 90322-41-1

:

2-Benzothiazolecarboxylicacid, 5-methoxy-

Description:
2-Benzothiazolecarboxylic acid, 5-methoxy- is an organic compound characterized by its benzothiazole structure, which consists of a benzene ring fused to a thiazole ring. This compound features a carboxylic acid functional group and a methoxy group at the 5-position of the thiazole ring, contributing to its chemical reactivity and potential applications. It is typically a crystalline solid, exhibiting moderate solubility in polar solvents due to the presence of the carboxylic acid group. The compound may display biological activity, making it of interest in pharmaceutical and agrochemical research. Its molecular structure allows for various chemical modifications, which can enhance its properties or efficacy in specific applications. Additionally, the presence of both electron-donating (methoxy) and electron-withdrawing (carboxylic acid) groups can influence its reactivity and interaction with other molecules. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C9H7NO3S
InChI:InChI=1S/C9H7NO3S/c1-13-5-2-3-7-6(4-5)10-8(14-7)9(11)12/h2-4H,1H3,(H,11,12)
InChI key:HZCUQHHEHCKENU-UHFFFAOYSA-N
SMILES:COC1=CC2=C(C=C1)SC(=N2)C(=O)O
Synonyms:
  • 5-Methoxybenzothiazole-2-carboxylicacid
Found 4 products.