CAS 90322-71-7

2-Carboxy-6-nitrobenzeneacetic acid

Description:

2-Carboxy-6-nitrobenzeneacetic acid, with the CAS number 90322-71-7, is an organic compound characterized by its aromatic structure featuring both carboxylic acid and nitro functional groups. This compound typically appears as a solid at room temperature and is soluble in polar solvents due to the presence of the carboxylic acid group, which can engage in hydrogen bonding. The nitro group contributes to its electron-withdrawing properties, influencing its reactivity and potential applications in organic synthesis. The presence of both functional groups suggests that it may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its stability under standard conditions is generally good, although it may be sensitive to strong reducing agents or extreme pH levels. Overall, 2-Carboxy-6-nitrobenzeneacetic acid is a versatile compound with potential applications in both synthetic chemistry and medicinal chemistry.

Formula: C₁₀H₉NO₆

InChI: InChI=1/C10H9NO6/c1-2-17-10(14)8-6(9(12)13)4-3-5-7(8)11(15)16/h3-5H,2H2,1H3,(H,12,13)

SMILES: CCOC(=O)c1c(cccc1N(=O)=O)C(=O)O

Synonyms:

• 1,2-Benzenedicarboxylic Acid, 3-Nitro-, 2-Ethyl Ester
• 2-(Ethoxycarbonyl)-3-nitrobenzoic acid