CymitQuimica logo

CAS 90322-89-7

:

1,5-Naphthyridine-3-carboxamide

Description:
1,5-Naphthyridine-3-carboxamide is a heterocyclic organic compound characterized by a naphthyridine ring system, which consists of a fused bicyclic structure containing nitrogen atoms. This compound features a carboxamide functional group, which contributes to its chemical reactivity and potential biological activity. Typically, 1,5-naphthyridine derivatives exhibit properties such as moderate solubility in polar solvents and can participate in hydrogen bonding due to the presence of the amide group. The nitrogen atoms in the naphthyridine ring can influence the compound's electronic properties, making it a candidate for various applications in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, compounds of this class may exhibit antimicrobial, antiviral, or anticancer activities, although specific biological activities can vary based on structural modifications. The compound's stability, reactivity, and potential interactions with biological targets make it of interest in both synthetic and medicinal chemistry research.
Formula:C9H7N3O
InChI:InChI=1S/C9H7N3O/c10-9(13)6-4-8-7(12-5-6)2-1-3-11-8/h1-5H,(H2,10,13)
InChI key:InChIKey=WXNZNIQENJBHBC-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=CC2=C(N=C1)C=CC=N2
Synonyms:
  • 1,5-Naphthyridine-3-carboxamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.