CymitQuimica logo

CAS 903269-75-0

:

5-Nitro-2-[(2-thienylmethyl)amino]benzonitrile

Description:
5-Nitro-2-[(2-thienylmethyl)amino]benzonitrile is an organic compound characterized by its complex structure, which includes a nitro group, an amino group, and a benzonitrile moiety. The presence of the nitro group typically imparts electron-withdrawing properties, influencing the compound's reactivity and potential applications in various chemical reactions. The thienylmethyl group contributes to the compound's overall hydrophobic character and may enhance its biological activity, making it of interest in medicinal chemistry. This compound is likely to exhibit moderate solubility in organic solvents, while its solubility in water may be limited due to the presence of the hydrophobic thienyl group. Additionally, the compound may display interesting pharmacological properties, which could be explored in drug development. Its specific interactions and stability would depend on various factors, including pH and temperature. As with many nitro-containing compounds, care should be taken regarding its handling and storage due to potential toxicity and environmental impact.
Formula:C12H9N3O2S
InChI:InChI=1S/C12H9N3O2S/c13-7-9-6-10(15(16)17)3-4-12(9)14-8-11-2-1-5-18-11/h1-6,14H,8H2
InChI key:InChIKey=TTWOCFMBKZTKMR-UHFFFAOYSA-N
SMILES:N(CC1=CC=CS1)C2=C(C#N)C=C(N(=O)=O)C=C2
Synonyms:
  • 5-Nitro-2-[(2-thienylmethyl)amino]benzonitrile
  • Benzonitrile, 5-nitro-2-[(2-thienylmethyl)amino]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.