CAS 903269-75-0: 5-Nitro-2-[(2-thienylmethyl)amino]benzonitrile

Description: 5-Nitro-2-[(2-thienylmethyl)amino]benzonitrile is an organic compound characterized by its complex structure, which includes a nitro group, an amino group, and a benzonitrile moiety. The presence of the nitro group typically imparts electron-withdrawing properties, influencing the compound's reactivity and potential applications in various chemical reactions. The thienylmethyl group contributes to the compound's overall hydrophobic character and may enhance its biological activity, making it of interest in medicinal chemistry. This compound is likely to exhibit moderate solubility in organic solvents, while its solubility in water may be limited due to the presence of the hydrophobic thienyl group. Additionally, the compound may display interesting pharmacological properties, which could be explored in drug development. Its specific interactions and stability would depend on various factors, including pH and temperature. As with many nitro-containing compounds, care should be taken regarding its handling and storage due to potential toxicity and environmental impact.

Formula: C₁₂H₉N₃O₂S

InChI: InChI=1S/C12H9N3O2S/c13-7-9-6-10(15(16)17)3-4-12(9)14-8-11-2-1-5-18-11/h1-6,14H,8H2

InChI key: InChIKey=TTWOCFMBKZTKMR-UHFFFAOYSA-N

SMILES: N#CC1=CC(=CC=C1NCC=2SC=CC2)N(=O)=O

5-Nitro-2-[(thien-2-ylmethyl)amino]benzonitrile

CAS: 903269-75-0

Please enquire for more information about 5-Nitro-2-[(thien-2-ylmethyl)amino]benzonitrile including the price, delivery time and more detailed …

• Formula: C₁₂H₉N₃O₂S
• Purity: Min. 95%
• Molecular weight: 259.28 g/mol