CAS 90329-50-3
:5-ethyl-1-methyl-1H-tetrazole
Description:
5-Ethyl-1-methyl-1H-tetrazole is an organic compound characterized by its tetrazole ring, which consists of four nitrogen atoms and one carbon atom, contributing to its unique chemical properties. This compound features an ethyl group and a methyl group attached to the tetrazole ring, influencing its solubility and reactivity. It is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols. The presence of multiple nitrogen atoms in its structure imparts potential for coordination with metal ions, making it of interest in various applications, including pharmaceuticals and materials science. Additionally, tetrazoles are known for their stability and can serve as precursors for the synthesis of other nitrogen-containing compounds. The compound's CAS number, 90329-50-3, is a unique identifier that facilitates its identification in chemical databases and regulatory frameworks. Overall, 5-ethyl-1-methyl-1H-tetrazole exhibits properties that make it valuable in both research and industrial contexts.
Formula:C4H8N4
InChI:InChI=1/C4H8N4/c1-3-4-5-6-7-8(4)2/h3H2,1-2H3
SMILES:CCc1nnnn1C
Synonyms:- 1H-tetrazole, 5-ethyl-1-methyl-
- 5-ETHYL-1-METHYL-1H-TETRAZOLE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
