CAS 90332-28-8

3,5,8-Trihydroxy-2-(3,4,5-trihydroxyphenyl)-4H-1-benzopyran-4-one

Description:

3,5,8-Trihydroxy-2-(3,4,5-trihydroxyphenyl)-4H-1-benzopyran-4-one, also known by its CAS number 90332-28-8, is a flavonoid compound characterized by its complex polyphenolic structure. This substance features multiple hydroxyl groups, which contribute to its potential antioxidant properties. The presence of the benzopyran moiety indicates that it belongs to the flavonoid class, which is known for various biological activities, including anti-inflammatory, antimicrobial, and anticancer effects. The specific arrangement of hydroxyl groups on the aromatic rings enhances its reactivity and solubility in polar solvents. Additionally, this compound may exhibit significant interactions with biological macromolecules, influencing cellular signaling pathways. Its structural characteristics suggest potential applications in pharmaceuticals and nutraceuticals, particularly in formulations aimed at promoting health and preventing oxidative stress-related diseases. However, further studies are necessary to fully elucidate its biological activities and therapeutic potential.

Formula: C₁₅H₁₀O₈

InChI: InChI=1S/C15H10O8/c16-6-1-2-7(17)15-10(6)12(21)13(22)14(23-15)5-3-8(18)11(20)9(19)4-5/h1-4,16-20,22H

InChI key: InChIKey=JGTKWAPKKUUANC-UHFFFAOYSA-N

SMILES: OC1=C2C(C(=O)C(O)=C(O2)C3=CC(O)=C(O)C(O)=C3)=C(O)C=C1

Synonyms:

• 3,5,8,3′,4′,5′-Hexahydroxyflavone
• 3,5,8-Trihydroxy-2-(3,4,5-trihydroxyphenyl)-4H-1-benzopyran-4-one
• 4H-1-Benzopyran-4-one, 3,5,8-trihydroxy-2-(3,4,5-trihydroxyphenyl)-
• Flavone, 3,3′,4′,5,5′,8-hexahydroxy-

3,3',4',5,5',8-Hexahydroxyflavone

CAS: 90332-28-8

3,3',4',5,5',8-Hexahydroxyflavone is a naturally occurring flavonoid, which is a type of polyphenolic compound. It is derived from various plant sources, including fruits, vegetables, and certain medicinal herbs. The compound is characterized by its chemical structure, which includes multiple hydroxyl groups, contributing to its biological activity.

The mode of action of 3,3',4',5,5',8-Hexahydroxyflavone involves its interaction with various cellular pathways and enzymes. Primarily, it is known for its antioxidant properties, where it scavenges free radicals and reactive oxygen species, thereby reducing oxidative stress. Additionally, it may exhibit anti-inflammatory effects by modulating signaling pathways involved in inflammation.

In terms of uses and applications, 3,3',4',5,5',8-Hexahydroxyflavone is primarily explored in scientific research focusing on its potential health benefits. Studies investigate its role in disease prevention, particularly conditions associated with oxidative stress and inflammation, such as cardiovascular diseases and neurodegenerative disorders. While it holds promise in these areas, further research is necessary to fully understand its mechanisms and therapeutic potential.

Formula: C₁₅H₁₀O₈

Purity: Min. 95%

Molecular weight: 318.24 g/mol

Ref: 3D-FH165767