CAS 90344-84-6
:6-deuterio-5-fluoro-1H-pyrimidine-2,4-dione
Description:
6-Deuterio-5-fluoro-1H-pyrimidine-2,4-dione, with the CAS number 90344-84-6, is a deuterated derivative of pyrimidine, a heterocyclic aromatic organic compound. This substance features a pyrimidine ring substituted with a fluorine atom at the 5-position and a deuterium atom at the 6-position, along with two keto groups at the 2 and 4 positions, which contribute to its dione classification. The presence of deuterium, a stable isotope of hydrogen, can influence the compound's physical and chemical properties, such as its reactivity and stability, compared to its non-deuterated counterpart. The fluorine substitution can enhance the compound's lipophilicity and may affect its biological activity, making it of interest in pharmaceutical research. Additionally, the compound's structure allows for potential applications in various fields, including medicinal chemistry and materials science. Its unique isotopic labeling can also be useful in studies involving metabolic pathways and tracer studies in biological systems.
Formula:C4H2DFN2O2
InChI:InChI=1/C4H3FN2O2/c5-2-1-6-4(9)7-3(2)8/h1H,(H2,6,7,8,9)/i1D
SMILES:c1(c(c(nc(n1)O)O)F)[2H]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-Fluorouracil-6-d1
CAS:Controlled ProductFormula:C4H2DFN2O2Color and Shape:NeatMolecular weight:131.08
