
CAS 90345-47-4
:4-Cyano-3,5-dimethyl-1H-pyrrole-2-carboxylic acid
Description:
4-Cyano-3,5-dimethyl-1H-pyrrole-2-carboxylic acid is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features a cyano group (-CN) and a carboxylic acid group (-COOH) attached to the pyrrole ring, along with two methyl groups at the 3 and 5 positions. The presence of the cyano group contributes to its potential reactivity, making it useful in various synthetic applications. The carboxylic acid functionality provides acidic properties, allowing for potential interactions in biochemical systems or as a precursor in organic synthesis. Additionally, the methyl substituents can influence the compound's solubility and stability. Overall, 4-Cyano-3,5-dimethyl-1H-pyrrole-2-carboxylic acid is of interest in fields such as medicinal chemistry and materials science due to its unique structural features and potential applications in the development of pharmaceuticals or agrochemicals.
Formula:C8H8N2O2
InChI:InChI=1S/C8H8N2O2/c1-4-6(3-9)5(2)10-7(4)8(11)12/h10H,1-2H3,(H,11,12)
InChI key:InChIKey=MXRLDGFCXONJMS-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C)C(C#N)=C(C)N1
Synonyms:- 4-Cyano-3,5-dimethyl-1H-pyrrole-2-carboxylic acid
- Pyrrole-2-carboxylic acid, 4-cyano-3,5-dimethyl-
- 1H-Pyrrole-2-carboxylic acid, 4-cyano-3,5-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.