CAS 90346-60-4
:ethyl [(4-chloropyridin-2-yl)oxy]acetate
Description:
Ethyl [(4-chloropyridin-2-yl)oxy]acetate, with the CAS number 90346-60-4, is an organic compound characterized by its ester functional group, which is formed from the reaction of ethyl alcohol and a carboxylic acid. This compound features a pyridine ring substituted with a chlorine atom at the 4-position and an ether linkage to an acetate group. Its molecular structure contributes to its potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the chloropyridine moiety may impart specific biological activities, making it of interest in medicinal chemistry. Ethyl [(4-chloropyridin-2-yl)oxy]acetate is typically a colorless to pale yellow liquid, exhibiting moderate solubility in organic solvents. Its reactivity can be influenced by the electron-withdrawing nature of the chlorine atom, which can affect its interaction with nucleophiles. As with many chemical substances, proper handling and safety precautions are essential due to potential toxicity and environmental impact.
Formula:C9H10ClNO3
InChI:InChI=1/C9H10ClNO3/c1-2-13-9(12)6-14-8-5-7(10)3-4-11-8/h3-5H,2,6H2,1H3
SMILES:CCOC(=O)COc1cc(ccn1)Cl
Synonyms:- Acetic Acid, 2-[(4-Chloro-2-Pyridinyl)Oxy]-, Ethyl Ester
- Ethyl [(4-chloropyridin-2-yl)oxy]acetate
- 2-[(4-chloro-2-pyridinyl)oxy]acetic acid ethyl ester
- ethyl 2-(4-chloropyridin-2-yloxy)acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

