CAS 90349-23-8

5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carboxylic acid

Description:

5,7-Dimethylpyrazolo[1,5-a]pyrimidine-3-carboxylic acid is a heterocyclic organic compound characterized by its pyrazolo-pyrimidine structure, which incorporates both pyrazole and pyrimidine rings. This compound features two methyl groups at the 5 and 7 positions of the pyrazole ring, contributing to its unique chemical properties. The presence of a carboxylic acid functional group at the 3-position enhances its acidity and reactivity, making it a potential candidate for various chemical reactions and applications. It is often studied for its biological activity, particularly in the context of medicinal chemistry, where such compounds may exhibit pharmacological properties. The molecular structure allows for potential interactions with biological targets, which can be explored in drug development. Additionally, its solubility and stability in various solvents can influence its behavior in chemical reactions and biological systems. Overall, 5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carboxylic acid represents a versatile compound with significant implications in both research and application.

Formula: C₉H₉N₃O₂

InChI: InChI=1/C9H9N3O2/c1-5-3-6(2)12-8(11-5)7(4-10-12)9(13)14/h3-4H,1-2H3,(H,13,14)

SMILES: Cc1cc(C)n2c(c(cn2)C(=O)O)n1

Synonyms:

• Pyrazolo[1,5-a]pyrimidine-3-carboxylic acid, 5,7-dimethyl-
• 5,7-Dimethylpyrazolo[1,5-a]pyrimidine-3-carboxylic acid

5,7-DIMETHYL-PYRAZOLO[1,5-A]PYRIMIDINE-3-CARBOXYLIC ACID

CAS: 90349-23-8

Formula: C₉H₉N₃O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 191.1867

Ref: IN-DA00GSTE

5,7-Dimethylpyrazolo[1,5-a]pyrimidine-3-carboxylic acid

CAS: 90349-23-8

5,7-Dimethylpyrazolo[1,5-a]pyrimidine-3-carboxylic acid

Purity: 98%

Molecular weight: 191.19g/mol

Ref: 54-OR470775

5,7-Dimethyl-pyrazolo[1,5- a ]pyrimidine-3-carboxylic acid

CAS: 90349-23-8

Formula: C₉H₉N₃O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 191.19

Ref: 10-F028203