CAS 903513-62-2

B-(2-Amino-4-pyridinyl)boronic acid

Description:

B-(2-Amino-4-pyridinyl)boronic acid is an organic compound characterized by the presence of a boronic acid functional group attached to a pyridine ring that has an amino substituent. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar solvents like water and methanol, and possessing a moderate melting point. The boronic acid moiety allows for the formation of reversible covalent bonds with diols, making it useful in various applications, including medicinal chemistry and materials science. The amino group on the pyridine ring can participate in hydrogen bonding and may influence the compound's reactivity and interaction with biological targets. Additionally, this compound may exhibit potential as a building block in the synthesis of more complex molecules, particularly in the development of pharmaceuticals. Its unique structural features contribute to its utility in research and development, particularly in the fields of drug discovery and organic synthesis.

Formula: C₅H₇BN₂O₂

InChI: InChI=1S/C5H7BN2O2/c7-5-3-4(6(9)10)1-2-8-5/h1-3,9-10H,(H2,7,8)

InChI key: InChIKey=AWBACOXFGYMTIX-UHFFFAOYSA-N

SMILES: B(O)(O)C=1C=C(N)N=CC1

Synonyms:

• (2-Aminopyridin-4-yl)boronic acid
• (2-Amino-4-pyridyl)boronic acid
• B-(2-Amino-4-pyridinyl)boronic acid
• Boronic acid, B-(2-amino-4-pyridinyl)-
• Boronic acid, (2-amino-4-pyridinyl)-

(2-AMINO-4-PYRIDYL)BORONIC ACID

CAS: 903513-62-2

Formula: C₅H₇BN₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 137.9323

Ref: IN-DA006RKW

(2-Aminopyridin-4-yl)boronic acid

CAS: 903513-62-2

(2-Aminopyridin-4-yl)boronic acid

Purity: 95%

Molecular weight: 137.93g/mol

Ref: 54-OR76411

(2-Aminopyridin-4-yl)boronic acid

CAS: 903513-62-2

Formula: C₅H₇BN₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 137.93

Ref: 10-F221542