CAS 903556-58-1

Carbamic acid, [1-(3-bromophenyl)ethyl]-, phenylmethyl ester

Description:

Carbamic acid, [1-(3-bromophenyl)ethyl]-, phenylmethyl ester, identified by CAS number 903556-58-1, is an organic compound characterized by its carbamate functional group. This compound features a phenylmethyl ester moiety, which contributes to its chemical properties and reactivity. The presence of the 3-bromophenyl group introduces a halogen substituent, which can influence the compound's biological activity and solubility. Typically, carbamic acids and their esters are known for their applications in pharmaceuticals and agrochemicals, often acting as intermediates or active ingredients. The structure suggests potential interactions with biological systems, making it of interest in medicinal chemistry. Additionally, the compound's stability, solubility in various solvents, and reactivity with nucleophiles or electrophiles can be influenced by the steric and electronic effects of the bromine atom and the aromatic rings. Overall, this compound exemplifies the diverse chemistry of carbamates and their potential utility in various chemical applications.

Formula: C₁₆H₁₆BrNO₂

InChI: InChI=1S/C16H16BrNO2/c1-12(14-8-5-9-15(17)10-14)18-16(19)20-11-13-6-3-2-4-7-13/h2-10,12H,11H2,1H3,(H,18,19)

InChI key: InChIKey=WUKNNBIUNQMMQF-UHFFFAOYSA-N

SMILES: C(NC(OCC1=CC=CC=C1)=O)(C)C2=CC(Br)=CC=C2

Synonyms:

• Carbamic acid, [1-(3-bromophenyl)ethyl]-, phenylmethyl ester