CymitQuimica logo

CAS 903556-82-1

:

5-Benzoxazolemethanamine, 2-methyl-, hydrochloride (1:1)

Description:
5-Benzoxazolemethanamine, 2-methyl-, hydrochloride (1:1) is a chemical compound characterized by its benzoxazole and amine functional groups. It typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, which is indicative of its polar nature due to the presence of the hydrochloride salt. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting specific receptors or pathways. Its molecular structure suggests potential interactions with biological systems, possibly influencing enzyme activity or receptor binding. The hydrochloride form enhances its stability and solubility, facilitating its use in various applications, including medicinal chemistry and biochemical studies. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information, as the specific biological effects and safety profile would depend on the context of its use and exposure levels.
Formula:C9H10N2O·ClH
InChI:InChI=1S/C9H10N2O.ClH/c1-6-11-8-4-7(5-10)2-3-9(8)12-6;/h2-4H,5,10H2,1H3;1H
InChI key:InChIKey=FMCIDNVYQOQGEB-UHFFFAOYSA-N
SMILES:CC=1OC=2C(=CC(CN)=CC2)N1.Cl
Synonyms:
  • 5-Benzoxazolemethanamine, 2-methyl-, hydrochloride (1:1)
  • 5-Benzoxazolemethanamine, 2-methyl-, monohydrochloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.