CAS 90357-58-7
:propyl hydroxyacetate
Description:
Propyl hydroxyacetate, with the CAS number 90357-58-7, is an organic compound characterized by its ester functional group. It is derived from the reaction of propanol and hydroxyacetic acid. This substance typically appears as a colorless to pale yellow liquid with a mild, sweet odor. It is known for its solubility in water and various organic solvents, making it versatile in applications such as solvents, flavoring agents, and in the formulation of personal care products. Propyl hydroxyacetate exhibits low toxicity, which contributes to its safety profile in consumer products. Additionally, it has a relatively low volatility, which can influence its behavior in different environments. Its chemical structure allows for hydrogen bonding, which can affect its physical properties, such as boiling point and viscosity. Overall, propyl hydroxyacetate is valued for its functional properties in both industrial and consumer applications.
Formula:C5H10O3
InChI:InChI=1/C5H10O3/c1-2-3-8-5(7)4-6/h6H,2-4H2,1H3
SMILES:CCCOC(=O)CO
Synonyms:- Acetic Acid, 2-Hydroxy-, Propyl Ester
- Acetic acid, hydroxy-, propyl ester
- Propyl glycolate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Propyl 2-Hydroxyacetic Acid Ester
CAS:Controlled ProductFormula:C5H10O3Color and Shape:NeatMolecular weight:118.13
