CAS 903581-02-2

N-[1-(5-chloro-2,3-dimethoxy-phenyl)ethyl]-5-fluoro-2-methylsulfonyl-aniline

Description:

N-[1-(5-chloro-2,3-dimethoxy-phenyl)ethyl]-5-fluoro-2-methylsulfonyl-aniline, with CAS number 903581-02-2, is a synthetic organic compound characterized by its complex molecular structure, which includes a chloro-substituted phenyl group, methoxy groups, and a sulfonamide functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the fluoro and sulfonyl groups may enhance its solubility and reactivity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The methoxy groups can influence the compound's electronic properties and steric hindrance, affecting its interaction with biological targets. Additionally, the chloro substituent may impart specific reactivity patterns, which can be exploited in synthetic applications. Overall, this compound's unique combination of functional groups suggests potential utility in various chemical and biological applications, warranting further investigation into its properties and effects.

Formula: C₁₇H₁₉ClFNO₄S

InChI: InChI=1/C17H19ClFNO4S/c1-10(13-7-11(18)8-15(23-2)17(13)24-3)20-14-9-12(19)5-6-16(14)25(4,21)22/h5-10,20H,1-4H3

SMILES: CC(c1cc(cc(c1OC)OC)Cl)Nc1cc(ccc1S(=O)(=O)C)F