CymitQuimica logo

CAS 903587-98-4

:

2,2,2-trichloroethyl imidazole-1-sulfonate

Description:
2,2,2-Trichloroethyl imidazole-1-sulfonate is a chemical compound characterized by its unique structure, which includes a trichloroethyl group and an imidazole ring with a sulfonate functional group. This compound typically appears as a white to off-white solid and is soluble in polar solvents, making it useful in various chemical applications. It is known for its potential as a reagent in organic synthesis, particularly in the formation of sulfonamides and other derivatives. The presence of the trichloroethyl group contributes to its reactivity, allowing it to participate in nucleophilic substitution reactions. Additionally, the imidazole moiety may impart biological activity, making it of interest in medicinal chemistry. Safety considerations are important when handling this compound, as it may pose health risks due to its chlorinated components. Proper storage and handling protocols should be followed to mitigate any hazards associated with exposure. Overall, 2,2,2-trichloroethyl imidazole-1-sulfonate is a versatile compound with applications in both synthetic and medicinal chemistry.
Formula:C5H5Cl3N2O3S
InChI:InChI=1/C5H5Cl3N2O3S/c6-5(7,8)3-13-14(11,12)10-2-1-9-4-10/h1-2,4H,3H2
SMILES:c1cn(cn1)S(=O)(=O)OCC(Cl)(Cl)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.