CymitQuimica logo

CAS 90361-95-8

:

methyl 3-pyrrol-1-ylpyrazine-2-carboxylate

Description:
Methyl 3-pyrrol-1-ylpyrazine-2-carboxylate, with the CAS number 90361-95-8, is a chemical compound characterized by its unique structure that includes a pyrrole and pyrazine moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups. The methyl ester functional group contributes to its chemical reactivity, making it a candidate for various synthetic applications. Additionally, compounds of this nature may display biological activity, which can be of interest in pharmaceutical research. The presence of nitrogen atoms in the heterocycles can influence the compound's electronic properties, potentially affecting its interaction with biological targets. Overall, methyl 3-pyrrol-1-ylpyrazine-2-carboxylate is a versatile compound with potential applications in medicinal chemistry and organic synthesis, although specific physical and chemical properties would need to be determined through experimental characterization.
Formula:C10H9N3O2
InChI:InChI=1/C10H9N3O2/c1-15-10(14)8-9(12-5-4-11-8)13-6-2-3-7-13/h2-7H,1H3
Synonyms:
  • Methyl 3-(1H-pyrrol-1-yl)pyrazine-2-carboxylate
  • 2-pyrazinecarboxylic acid, 3-(1H-pyrrol-1-yl)-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.