CAS 90365-74-5
:(3S,4S)-(+)-1-Benzyl-3,4-pyrrolidindiol
Description:
(3S,4S)-(+)-1-Benzyl-3,4-pyrrolidindiol, with the CAS number 90365-74-5, is a chiral organic compound characterized by its pyrrolidine structure, which features two hydroxyl groups at the 3 and 4 positions of the pyrrolidine ring. This compound is notable for its stereochemistry, specifically the (3S,4S) configuration, which contributes to its potential biological activity and interactions. The presence of the benzyl group enhances its lipophilicity, potentially influencing its solubility and permeability in biological systems. As a diol, it can participate in hydrogen bonding, making it relevant in various chemical reactions and applications, including synthesis and medicinal chemistry. The compound may exhibit specific pharmacological properties, although detailed studies would be necessary to elucidate its biological effects and mechanisms of action. Its chirality and functional groups make it a candidate for further research in the fields of drug development and organic synthesis.
Formula:C11H16NO2
InChI:InChI=1/C11H15NO2/c13-10-7-12(8-11(10)14)6-9-4-2-1-3-5-9/h1-5,10-11,13-14H,6-8H2/p+1/t10-,11-/m0/s1
Synonyms:- (3S,4S)-1-Benzylpyrrolidine-3,4-diol
- 3,4-Pyrrolidinediol, 1-(phenylmethyl)-, (3S,4S)-
- (3S,4S)-1-benzyl-3,4-dihydroxypyrrolidinium
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(3S,4S)-(+)-1-Benzyl-3,4-pyrrolidindiol
CAS:Formula:C11H15NO2Purity:98%Color and Shape:SolidMolecular weight:193.2423(3S,4S)-(+)-1-Benzyl-3,4-pyrrolidindiol
CAS:(3S,4S)-(+)-1-Benzyl-3,4-pyrrolidindiolPurity:98%Molecular weight:193.24g/mol(3S,4S)-(-)-1-Benzyl-3,4-pyrrolidinediol
CAS:Formula:C11H15NO2Purity:97%Color and Shape:SolidMolecular weight:193.246(3S,4S)-(+)-1-Benzyl-3,4-pyrrolidinediol
CAS:Controlled ProductApplications (3S,4S)-(+)-1-Benzyl-3,4-pyrrolidinediol is used as a reagent in organic synthesis including that of pyrrolidine iminocyclitol α-glucosidase inhibitors and (-)-(1R,2R,7S,8aR)-1,2,7-Trihydroxyindolizidine ((-)-7S-OH-Lentiginosine) which has potential proapoptotic properties.
References Guerreiro, L., et al.: Bioorg. Med. Chem., 21, 1911 (2013); Cordero, F., et al.: ChemPlusChem, 77, 224 (2012);Formula:C11H15NO2Color and Shape:NeatMolecular weight:193.24



