CAS 90381-07-0
:5-Chloro-2-(trifluoromethyl)benzaldehyde
Description:
5-Chloro-2-(trifluoromethyl)benzaldehyde is an aromatic aldehyde characterized by the presence of a chloro group and a trifluoromethyl group attached to a benzene ring. This compound features a benzaldehyde functional group, which is known for its reactivity in various organic synthesis reactions, particularly in nucleophilic additions and condensation reactions. The presence of the trifluoromethyl group significantly influences its electronic properties, enhancing its lipophilicity and potentially increasing its reactivity due to the strong electron-withdrawing nature of the fluorine atoms. The chloro substituent also contributes to the compound's overall reactivity and can participate in further chemical transformations. Typically, this compound is utilized in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals. Its physical properties, such as boiling point and solubility, are influenced by the substituents on the benzene ring, making it an interesting compound for study in both synthetic and medicinal chemistry contexts. Safety precautions should be observed when handling this compound due to its potential toxicity and reactivity.
Formula:C8H4ClF3O
InChI:InChI=1/C8H4ClF3O/c9-6-1-2-7(8(10,11)12)5(3-6)4-13/h1-4H
SMILES:c1cc(c(cc1Cl)C=O)C(F)(F)F
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-Chloro-2-(trifluoromethyl)benzaldehyde
CAS:Formula:C8H4ClF3OPurity:96%Color and Shape:LiquidMolecular weight:208.56505-Chloro-2-(trifluoromethyl)benzaldehyde
CAS:5-Chloro-2-(trifluoromethyl)benzaldehydeFormula:C8H4ClF3OPurity:98%Color and Shape: clear. colourless liquidMolecular weight:208.56496g/mol5-Chloro-2-(trifluoromethyl)benzaldehyde
CAS:5-Chloro-2-(trifluoromethyl)benzaldehyde is a fine chemical that can be used as a versatile building block for organic synthesis. It has CAS number 90381-07-0 and is an intermediate in the synthesis of a variety of organic compounds. 5-Chloro-2-(trifluoromethyl)benzaldehyde is also an effective reagent for the preparation of complex compounds. It is soluble in polar solvents, such as chloroform, ethanol, ether, acetone, and benzene.Formula:C8H4ClF3OPurity:Min. 95%Molecular weight:208.56 g/mol5-Chloro-2-trifluoromethyl-benzaldehyde
CAS:Formula:C8H4ClF3OPurity:96%Color and Shape:LiquidMolecular weight:208.56



