
CAS 90381-45-6
:4,7-Dimethoxy-1-naphthalenecarboxylic acid
Description:
4,7-Dimethoxy-1-naphthalenecarboxylic acid is an organic compound characterized by its naphthalene structure, which consists of two fused benzene rings. The presence of two methoxy groups (-OCH3) at the 4 and 7 positions enhances its solubility in organic solvents and may influence its reactivity and biological activity. The carboxylic acid functional group (-COOH) at the 1-position contributes to its acidity and potential for forming hydrogen bonds, which can affect its interactions in various chemical environments. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its molecular structure suggests potential applications in materials science and medicinal chemistry, particularly due to the naphthalene core, which is known for its aromatic properties. Additionally, the presence of methoxy groups can modify the electronic properties of the molecule, potentially impacting its behavior in chemical reactions and interactions with biological systems. Safety data and handling precautions should be observed, as with all chemical substances.
Formula:C13H12O4
InChI:InChI=1S/C13H12O4/c1-16-8-3-4-9-11(7-8)10(13(14)15)5-6-12(9)17-2/h3-7H,1-2H3,(H,14,15)
InChI key:InChIKey=PCBJZCAKNURVSK-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C2=C(C(OC)=CC1)C=CC(OC)=C2
Synonyms:- 4,7-Dimethoxy-1-naphthalenecarboxylic acid
- 4,7-Dimethoxy-1-naphthoic acid
- 4,7-dimethoxynaphthalene-1-carboxylic acid
- 1-Naphthalenecarboxylic acid, 4,7-dimethoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
