CAS 903822-32-2
:N-(2-amino-5-methoxy-phenyl)-2-methyl-propanamide
Description:
N-(2-amino-5-methoxy-phenyl)-2-methyl-propanamide, identified by its CAS number 903822-32-2, is an organic compound characterized by its amide functional group, which is formed from the reaction of an amine and a carboxylic acid. This compound features a substituted phenyl ring, with an amino group and a methoxy group, contributing to its potential biological activity. The presence of the 2-methyl-propanamide moiety suggests that it may exhibit specific steric and electronic properties, influencing its solubility and reactivity. Typically, compounds of this nature may be investigated for their pharmacological properties, as the structural features can play a significant role in interactions with biological targets. Additionally, the methoxy group can enhance lipophilicity, potentially affecting the compound's absorption and distribution in biological systems. Overall, the characteristics of this compound suggest it may be of interest in medicinal chemistry and drug development, although specific biological activities would require empirical investigation.
Formula:C11H16N2O2
InChI:InChI=1/C11H16N2O2/c1-7(2)11(14)13-10-6-8(15-3)4-5-9(10)12/h4-7H,12H2,1-3H3,(H,13,14)
SMILES:CC(C)C(=Nc1cc(ccc1N)OC)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.