CAS 903886-81-7

N-{4-[2-(4-phenoxyphenoxy)-1,3-thiazol-5-yl]but-3-yn-2-yl}acetamide

Description:

N-{4-[2-(4-phenoxyphenoxy)-1,3-thiazol-5-yl]but-3-yn-2-yl}acetamide is a synthetic organic compound characterized by its complex structure, which includes a thiazole ring, an acetamide functional group, and a phenoxyphenyl moiety. The presence of the thiazole ring suggests potential biological activity, as thiazoles are often found in pharmaceuticals and agrochemicals. The compound features a but-3-yn-2-yl side chain, indicating the presence of a triple bond, which can influence its reactivity and stability. The phenoxy groups contribute to the compound's lipophilicity, potentially affecting its solubility and permeability in biological systems. This compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its CAS number, 903886-81-7, allows for easy identification and retrieval of information in chemical databases. Overall, the unique combination of functional groups and structural features positions this compound as a subject of interest in various chemical and biological studies.

Formula: C₂₁H₁₈N₂O₃S

InChI: InChI=1/C21H18N2O3S/c1-15(23-16(2)24)8-13-20-14-22-21(27-20)26-19-11-9-18(10-12-19)25-17-6-4-3-5-7-17/h3-7,9-12,14-15H,1-2H3,(H,23,24)

SMILES: CC(C#Cc1cnc(Oc2ccc(cc2)Oc2ccccc2)s1)N=C(C)O