
CAS 90389-57-4
:Benzenemethanamine, 4-bromo-N-butyl-, hydrochloride (1:1)
Description:
Benzenemethanamine, 4-bromo-N-butyl-, hydrochloride (1:1), also known by its CAS number 90389-57-4, is a chemical compound characterized by its amine functional group and a bromine substituent on the benzene ring. This compound features a butyl group attached to the nitrogen atom, which contributes to its hydrophobic properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its stability and solubility in polar solvents, particularly water. The presence of the bromine atom can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Its structural characteristics suggest potential applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Safety data should be consulted, as compounds with amine groups can exhibit toxicity and require careful handling. Overall, this compound exemplifies the diverse functionalities that can arise from simple organic structures, making it of interest in both research and industrial contexts.
Formula:C11H16BrN·ClH
InChI:InChI=1S/C11H16BrN.ClH/c1-2-3-8-13-9-10-4-6-11(12)7-5-10;/h4-7,13H,2-3,8-9H2,1H3;1H
InChI key:InChIKey=NPFMCGRLOCPJDI-UHFFFAOYSA-N
SMILES:C(NCCCC)C1=CC=C(Br)C=C1.Cl
Synonyms:- Benzenemethanamine, 4-bromo-N-butyl-, hydrochloride
- Benzenemethanamine, 4-bromo-N-butyl-, hydrochloride (1:1)
- Benzylamine, p-bromo-N-butyl-, hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.