
CAS 90389-70-1
:Benzenemethanamine, N-methyl-3-nitro-, hydrochloride (1:1)
Description:
Benzenemethanamine, N-methyl-3-nitro-, hydrochloride (1:1), commonly referred to as a nitroaniline derivative, is a chemical compound characterized by its amine functional group and nitro substituent on the aromatic ring. This compound typically appears as a crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility compared to the free base. The presence of the nitro group contributes to its potential reactivity and applications in organic synthesis, particularly in the production of dyes, pharmaceuticals, and agrochemicals. The N-methyl substitution indicates that a methyl group is attached to the nitrogen atom of the amine, which can influence the compound's biological activity and interaction with other molecules. As with many nitro compounds, it may exhibit specific toxicological properties, necessitating careful handling and consideration of safety protocols in laboratory and industrial settings. Overall, this compound's unique structure imparts distinct chemical properties that are valuable in various chemical applications.
Formula:C8H10N2O2·ClH
InChI:InChI=1S/C8H10N2O2.ClH/c1-9-6-7-3-2-4-8(5-7)10(11)12;/h2-5,9H,6H2,1H3;1H
InChI key:InChIKey=PBYAYJHCOPZPDI-UHFFFAOYSA-N
SMILES:C(NC)C1=CC(N(=O)=O)=CC=C1.Cl
Synonyms:- Benzenemethanamine, N-methyl-3-nitro-, monohydrochloride
- Benzenemethanamine, N-methyl-3-nitro-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.