CAS 90389-90-5

3-Chloro-N-pentylbenzenemethanamine

Description:

3-Chloro-N-pentylbenzenemethanamine, identified by its CAS number 90389-90-5, is an organic compound characterized by the presence of a chlorinated aromatic ring and an amine functional group. This compound features a pentyl chain attached to the nitrogen atom, which contributes to its hydrophobic properties. The chlorine atom is positioned on the aromatic ring, influencing the compound's reactivity and potential interactions with other substances. Typically, compounds of this nature may exhibit moderate solubility in organic solvents while being less soluble in water due to their hydrophobic characteristics. The presence of the amine group suggests potential basicity and the ability to form hydrogen bonds, which can affect its behavior in biological systems and chemical reactions. Additionally, the compound may have applications in various fields, including pharmaceuticals and agrochemicals, although specific uses would depend on further research into its biological activity and chemical stability. Safety and handling precautions are essential, as with many amines and chlorinated compounds, due to potential toxicity and environmental impact.

Formula: C₁₂H₁₈ClN

InChI: InChI=1S/C12H18ClN/c1-2-3-4-8-14-10-11-6-5-7-12(13)9-11/h5-7,9,14H,2-4,8,10H2,1H3

InChI key: InChIKey=QMXXEPWURVQBKU-UHFFFAOYSA-N

SMILES: C(NCCCCC)C1=CC(Cl)=CC=C1

Synonyms:

• [(3-Chlorophenyl)methyl](pentyl)amine
• 3-Chloro-N-pentylbenzenemethanamine
• Benzenemethanamine, 3-chloro-N-pentyl-