CAS 90389-92-7

N-(3-bromobenzyl)propan-1-amine

Description:

N-(3-bromobenzyl)propan-1-amine is an organic compound characterized by its amine functional group and a bromobenzyl substituent. It features a propan-1-amine backbone, which consists of a three-carbon chain terminating in an amine group (-NH2). The presence of the 3-bromobenzyl group indicates that a bromine atom is attached to the benzene ring at the meta position relative to the amine side chain. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in polar solvents. Additionally, the bromine substituent may impart unique reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or as intermediates in organic synthesis. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity.

Formula: C₁₀H₁₄BrN

InChI: InChI=1/C10H14BrN/c1-2-6-12-8-9-4-3-5-10(11)7-9/h3-5,7,12H,2,6,8H2,1H3

SMILES: CCCNCc1cccc(c1)Br

Synonyms:

• benzenemethanamine, 3-bromo-N-propyl-

N-(3-bromobenzyl)-1-propanamine hydrochloride

CAS: 90389-92-7

Formula: C₁₀H₁₅BrClN

Purity: 95.0%

Molecular weight: 264.59

Ref: 10-F361816