
CAS 90389-94-9
:N-Ethyl-3-iodobenzenemethanamine
Description:
N-Ethyl-3-iodobenzenemethanamine, with the CAS number 90389-94-9, is an organic compound characterized by its structure, which includes an ethyl group, an iodine atom, and an amine functional group attached to a benzene ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its potential applications in medicinal chemistry, particularly in the synthesis of pharmaceuticals and as a building block for various organic reactions. The presence of the iodine atom can impart unique reactivity, making it useful in nucleophilic substitution reactions. Additionally, the amine group contributes to its basicity and potential for forming salts with acids. Safety considerations should be taken into account, as compounds containing iodine and amines can pose health risks if not handled properly. Overall, N-Ethyl-3-iodobenzenemethanamine is a compound of interest in both research and industrial applications due to its functional groups and reactivity.
Formula:C9H12IN
InChI:InChI=1S/C9H12IN/c1-2-11-7-8-4-3-5-9(10)6-8/h3-6,11H,2,7H2,1H3
InChI key:InChIKey=ZTWPXWGSUQMMGY-UHFFFAOYSA-N
SMILES:C(NCC)C1=CC(I)=CC=C1
Synonyms:- Benzenemethanamine, N-ethyl-3-iodo-
- N-Ethyl-3-iodobenzenemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.