
CAS 903891-79-2
:Piperidine, 4-(2-methylpropoxy)-, hydrochloride (1:1)
Description:
Piperidine, 4-(2-methylpropoxy)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated heterocycle containing one nitrogen atom. This compound features a 4-substituent, specifically a 2-methylpropoxy group, which contributes to its unique properties and potential applications. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various chemical and pharmaceutical contexts. The presence of the hydrochloride indicates that the compound is protonated, which can influence its reactivity and interaction with biological systems. Piperidine derivatives are often studied for their pharmacological properties, including potential roles as intermediates in drug synthesis or as active pharmaceutical ingredients. The specific characteristics, such as melting point, boiling point, and spectral data, would require further investigation through experimental methods or literature sources. Overall, this compound exemplifies the diverse chemistry associated with piperidine derivatives and their relevance in medicinal chemistry.
Formula:C9H19NO·ClH
InChI:InChI=1S/C9H19NO.ClH/c1-8(2)7-11-9-3-5-10-6-4-9;/h8-10H,3-7H2,1-2H3;1H
InChI key:InChIKey=HTECFPXXOGANPY-UHFFFAOYSA-N
SMILES:O(CC(C)C)C1CCNCC1.Cl
Synonyms:- 4-(Isobutyloxy)piperidine hydrochloride
- Piperidine, 4-(2-methylpropoxy)-, hydrochloride
- Piperidine, 4-(2-methylpropoxy)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.