CAS 90390-17-3
:2,5-Dichloro-N-ethylbenzenemethanamine
Description:
2,5-Dichloro-N-ethylbenzenemethanamine, identified by its CAS number 90390-17-3, is an organic compound characterized by the presence of a benzene ring substituted with two chlorine atoms at the 2 and 5 positions, an ethyl group, and an amine functional group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The dichloro substitution can enhance its reactivity and may affect its biological activity, making it of interest in various chemical applications, including potential use in pharmaceuticals or agrochemicals. The presence of chlorine atoms can also impart unique electronic properties, influencing the compound's behavior in chemical reactions. Safety data and handling precautions are essential, as halogenated compounds can pose environmental and health risks. Overall, 2,5-Dichloro-N-ethylbenzenemethanamine is a compound of interest in both synthetic chemistry and potential industrial applications.
Formula:C9H11Cl2N
InChI:InChI=1S/C9H11Cl2N/c1-2-12-6-7-5-8(10)3-4-9(7)11/h3-5,12H,2,6H2,1H3
InChI key:InChIKey=YESYSJRLNWOYIG-UHFFFAOYSA-N
SMILES:C(NCC)C1=C(Cl)C=CC(Cl)=C1
Synonyms:- (2,5-Dichloro-benzyl)-ethyl-amine
- 2,5-Dichloro-N-ethylbenzenemethanamine
- Benzenemethanamine, 2,5-dichloro-N-ethyl-
- [(2,5-Dichlorophenyl)methyl](ethyl)amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.