CAS 90390-20-8

N-(3,4-dichlorobenzyl)propan-1-amine

Description:

N-(3,4-dichlorobenzyl)propan-1-amine, with the CAS number 90390-20-8, is an organic compound characterized by its amine functional group and a dichlorobenzyl substituent. This compound features a propan-1-amine backbone, which contributes to its basicity and potential reactivity. The presence of the 3,4-dichlorobenzyl group introduces significant steric hindrance and electronic effects due to the chlorine substituents, which can influence the compound's solubility, stability, and interaction with biological systems. Typically, compounds of this nature may exhibit properties such as moderate to high polarity, making them soluble in polar solvents while potentially being less soluble in non-polar environments. Additionally, the presence of the amine group suggests that it may participate in hydrogen bonding, affecting its physical properties and reactivity. Such compounds are often of interest in medicinal chemistry and pharmacology due to their potential biological activity, although specific applications and effects would depend on further empirical studies.

Formula: C₁₀H₁₃Cl₂N

InChI: InChI=1/C10H13Cl2N/c1-2-5-13-7-8-3-4-9(11)10(12)6-8/h3-4,6,13H,2,5,7H2,1H3

SMILES: CCCNCc1ccc(c(c1)Cl)Cl

Synonyms:

• Benzenemethanamine, 3,4-dichloro-N-propyl-

[(3,4-dichlorophenyl)methyl](propyl)amine

CAS: 90390-20-8

Formula: C₁₀H₁₃Cl₂N

Purity: 95.0%

Molecular weight: 218.12

Ref: 10-F523048