CAS 90392-32-8
:6,9-diazaspiro[4.5]decane-7,10-dione
Description:
6,9-Diazaspiro[4.5]decane-7,10-dione is a bicyclic compound characterized by its unique spiro structure, which consists of two nitrogen atoms incorporated into a decane framework. This compound features a dione functional group, indicating the presence of two carbonyl (C=O) groups, which significantly influence its reactivity and properties. The nitrogen atoms contribute to the basicity and potential for forming coordination complexes with metal ions. The spiro arrangement introduces strain and rigidity to the molecular structure, which can affect its physical properties, such as melting and boiling points, as well as solubility in various solvents. Additionally, the presence of the dione groups may enhance its reactivity in organic synthesis, making it a potential candidate for various chemical transformations. Due to its structural features, this compound may also exhibit interesting biological activities, although specific biological data would require further investigation. Overall, 6,9-diazaspiro[4.5]decane-7,10-dione represents a fascinating subject for study in both synthetic and medicinal chemistry contexts.
Formula:C8H12N2O2
InChI:InChI=1/C8H12N2O2/c11-6-5-9-7(12)8(10-6)3-1-2-4-8/h1-5H2,(H,9,12)(H,10,11)
SMILES:C1CCC2(C1)C(=NCC(=N2)O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.