CAS 90396-00-2

3-[(4-chlorophenyl)sulfonyl]propanoate

Description:

3-[(4-Chlorophenyl)sulfonyl]propanoate, with the CAS number 90396-00-2, is an organic compound characterized by the presence of a propanoate group attached to a sulfonyl moiety that is further substituted with a 4-chlorophenyl group. This compound typically exhibits properties associated with both the sulfonyl functional group and the ester functionality of the propanoate. It is likely to be a solid at room temperature, with potential solubility in polar organic solvents due to the presence of the sulfonyl group, which can engage in hydrogen bonding. The chlorophenyl substituent may impart specific electronic properties, influencing the compound's reactivity and interactions in chemical reactions. Additionally, compounds of this nature may have applications in pharmaceuticals or agrochemicals, given the structural motifs that are often associated with biological activity. Safety and handling precautions should be observed, as with many sulfonyl-containing compounds, due to potential toxicity or reactivity.

Formula: C₉H₈ClO₄S

InChI: InChI=1/C9H9ClO4S/c10-7-1-3-8(4-2-7)15(13,14)6-5-9(11)12/h1-4H,5-6H2,(H,11,12)/p-1

SMILES: c1cc(ccc1Cl)S(=O)(=O)CCC(=O)O

Synonyms:

• Propanoic Acid, 3-[(4-Chlorophenyl)Sulfonyl]-

propanoic acid, 3-[(4-chlorophenyl)sulfonyl]-

CAS: 90396-00-2

Formula: C₉H₉ClO₄S

Purity: 98%

Color and Shape: Solid

Molecular weight: 248.6834

Ref: IN-DA006QMS

3-(4-Chloro-benzenesulfonyl)-propionic acid

CAS: 90396-00-2

3-(4-Chloro-benzenesulfonyl)-propionic acid

Purity: 98%

Molecular weight: 248.68g/mol

Ref: 54-OR76489

3-(4-Chloro-benzenesulfonyl)-propionic acid

CAS: 90396-00-2

Formula: C₉H₉ClO₄S

Purity: 98%

Molecular weight: 248.68

Ref: 10-F059843