
CAS 90402-40-7
:Abanoquil
Description:
Abanoquil, identified by the CAS number 90402-40-7, is a chemical compound that has been studied primarily for its potential applications in the field of pharmaceuticals. While specific characteristics such as its molecular structure, physical properties, and biological activity may not be widely documented in public databases, compounds in this category often exhibit unique pharmacological properties. Typically, such substances may possess characteristics like moderate to high solubility in organic solvents, stability under various conditions, and the ability to interact with biological targets, which can lead to therapeutic effects. The safety profile, including toxicity and environmental impact, is also crucial for its application. As with many chemical substances, detailed studies and peer-reviewed research are essential to fully understand its properties and potential uses. For precise information, including synthesis methods and specific applications, consulting specialized literature or databases is recommended.
Formula:C22H25N3O4
InChI:InChI=1S/C22H25N3O4/c1-26-18-7-13-5-6-25(12-14(13)8-19(18)27-2)22-10-16(23)15-9-20(28-3)21(29-4)11-17(15)24-22/h7-11H,5-6,12H2,1-4H3,(H2,23,24)
InChI key:InChIKey=ANZIISNSHPKVRV-UHFFFAOYSA-N
SMILES:NC=1C2=C(N=C(C1)N3CC=4C(CC3)=CC(OC)=C(OC)C4)C=C(OC)C(OC)=C2
Synonyms:- Abanoquil
- 2-(3,4-Dihydro-6,7-dimethoxy-2(1H)-isoquinolinyl)-6,7-dimethoxy-4-quinolinamine
- Albanoquil
- 4-Quinolinamine, 2-(3,4-dihydro-6,7-dimethoxy-2(1H)-isoquinolinyl)-6,7-dimethoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Abanoquil
CAS:Abanoquil is an antagonist of alpha-1 adrenoceptor.Formula:C22H25N3O4Color and Shape:SolidMolecular weight:395.45
