CAS 90407-29-7

7-Nitro-1,2-benzisothiazol-3-amine

Description:

7-Nitro-1,2-benzisothiazol-3-amine is a chemical compound characterized by its unique structure, which includes a benzisothiazole core with a nitro group and an amino group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the nitro and amino functional groups. It is often used in various applications, including as a reagent in organic synthesis and in the development of pharmaceuticals. The presence of the nitro group may impart specific reactivity, making it useful in further chemical transformations. Additionally, the benzisothiazole moiety is known for its role in medicinal chemistry, contributing to the compound's potential as a bioactive agent. Safety and handling considerations are essential, as nitro compounds can be sensitive and may pose health risks. Overall, 7-Nitro-1,2-benzisothiazol-3-amine is a compound of interest in both research and industrial applications, warranting further investigation into its properties and potential uses.

Formula: C₇H₅N₃O₂S

InChI: InChI=1S/C7H5N3O2S/c8-7-4-2-1-3-5(10(11)12)6(4)13-9-7/h1-3H,(H2,8,9)

InChI key: InChIKey=QXUUUKIOABPJFD-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C2C(C(N)=NS2)=CC=C1

Synonyms:

• 1,2-Benzisothiazol-3-amine, 7-nitro-
• 7-Nitro-1,2-benzisothiazol-3-amine