
CAS 904085-98-9
:3-(5-Isothiazolyl)benzoic acid
Description:
3-(5-Isothiazolyl)benzoic acid is an organic compound characterized by a benzoic acid structure substituted with a 5-isothiazolyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the isothiazole moiety, which is known for its antimicrobial and antifungal properties. The carboxylic acid functional group contributes to its acidity and solubility in polar solvents. Additionally, the compound may display moderate to high stability under standard conditions, although its reactivity can be influenced by the presence of the isothiazole ring, which can participate in various chemical reactions. Its applications may extend to pharmaceuticals, agrochemicals, or as a building block in organic synthesis. As with many chemical substances, safety data should be consulted to understand its handling and potential hazards. Overall, 3-(5-Isothiazolyl)benzoic acid represents a versatile compound with interesting chemical and biological properties.
Formula:C10H7NO2S
InChI:InChI=1S/C10H7NO2S/c12-10(13)8-3-1-2-7(6-8)9-4-5-11-14-9/h1-6H,(H,12,13)
InChI key:InChIKey=FOMBLNHQUFNKKY-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(C=CC1)C2=CC=NS2
Synonyms:- 3-(5-Isothiazolyl)benzoic acid
- Benzoic acid, 3-(5-isothiazolyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

