CAS 904086-00-6
:3-(5-Isothiazolyl)benzenamine
Description:
3-(5-Isothiazolyl)benzenamine, identified by its CAS number 904086-00-6, is an organic compound characterized by the presence of both an isothiazole ring and an aniline structure. The isothiazole moiety contributes to its potential biological activity, as compounds containing this heterocyclic structure are often associated with antimicrobial and antifungal properties. The benzenamine part of the molecule indicates that it has an amino group (-NH2) attached to a benzene ring, which can influence its reactivity and solubility. This compound may exhibit polar characteristics due to the amino group, affecting its interactions in various chemical environments. Additionally, the presence of the isothiazole ring can enhance its stability and reactivity in certain chemical reactions. Overall, 3-(5-Isothiazolyl)benzenamine is of interest in medicinal chemistry and materials science, where its unique structural features may be leveraged for the development of new therapeutic agents or functional materials.
Formula:C9H8N2S
InChI:InChI=1S/C9H8N2S/c10-8-3-1-2-7(6-8)9-4-5-11-12-9/h1-6H,10H2
InChI key:InChIKey=VIVGZELEQSMMCF-UHFFFAOYSA-N
SMILES:NC=1C=C(C=CC1)C2=CC=NS2
Synonyms:- 3-(5-Isothiazolyl)benzenamine
- Benzenamine, 3-(5-isothiazolyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
