CAS 904086-06-2

3′-(Methylthio)[1,1′-biphenyl]-4-ol

Description:

3′-(Methylthio)[1,1′-biphenyl]-4-ol, identified by its CAS number 904086-06-2, is an organic compound characterized by the presence of a biphenyl structure substituted with a methylthio group and a hydroxyl group. This compound features a biphenyl backbone, which consists of two phenyl rings connected by a single bond, enhancing its stability and potential for various chemical interactions. The methylthio group (-S-CH3) introduces a sulfur atom into the structure, which can influence the compound's reactivity and solubility properties. The hydroxyl group (-OH) contributes to its polarity, making it more soluble in polar solvents and potentially increasing its reactivity in various chemical reactions, such as hydrogen bonding or nucleophilic substitution. The presence of these functional groups suggests that 3′-(Methylthio)[1,1′-biphenyl]-4-ol may exhibit interesting biological activities, making it a candidate for further research in medicinal chemistry and material science. Its specific applications and behavior would depend on the context of its use and the conditions under which it is studied.

Formula: C₁₃H₁₂OS

InChI: InChI=1S/C13H12OS/c1-15-13-4-2-3-11(9-13)10-5-7-12(14)8-6-10/h2-9,14H,1H3

InChI key: InChIKey=PPKUNSKCGLTKBK-UHFFFAOYSA-N

SMILES: S(C)C=1C=C(C=CC1)C2=CC=C(O)C=C2

Synonyms:

• [1,1′-Biphenyl]-4-ol, 3′-(methylthio)-
• 3′-(Methylthio)[1,1′-biphenyl]-4-ol